C15H21N4O2+ — CID 7619386
dimethyl-[3-[(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]propyl]azanium (PubChem CID 7619386) has the molecular formula C15H21N4O2+ and a molecular weight of 289.36 g/mol. Its IUPAC name is dimethyl-[3-[(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]propyl]azanium.
| Compound Name | dimethyl-[3-[(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 7619386 |
| Molecular Formula | C15H21N4O2+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | dimethyl-[3-[(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)amino]propyl]azanium |
| SMILES | Cn1c(=O)c(C(=O)NCCC[NH+](C)C)cc2cccnc21 |
| InChI | InChI=1S/C15H20N4O2/c1-18(2)9-5-8-17-14(20)12-10-11-6-4-7-16-13(11)19(3)15(12)21/h4,6-7,10H,5,8-9H2,1-3H3,(H,17,20)/p+1 |
| InChIKey | OYGGDVHXDLAOJS-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|