C16H14N2O4 — CID 123276386
2-(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)cyclohexane-1,3-dione (PubChem CID 123276386) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)cyclohexane-1,3-dione.
| Compound Name | 2-(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123276386 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(1-methyl-2-oxo-1,8-naphthyridine-3-carbonyl)cyclohexane-1,3-dione |
| SMILES | Cn1c(=O)c(C(=O)C2C(=O)CCCC2=O)cc2cccnc21 |
| InChI | InChI=1S/C16H14N2O4/c1-18-15-9(4-3-7-17-15)8-10(16(18)22)14(21)13-11(19)5-2-6-12(13)20/h3-4,7-8,13H,2,5-6H2,1H3 |
| InChIKey | JEFSYBZZDDZJIX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|