C7H9N3O3 — CID 130708433
N,3-dimethyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 130708433) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is N,3-dimethyl-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N,3-dimethyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 130708433 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N,3-dimethyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1c[nH]c(=O)n(C)c1=O |
| InChI | InChI=1S/C7H9N3O3/c1-8-5(11)4-3-9-7(13)10(2)6(4)12/h3H,1-2H3,(H,8,11)(H,9,13) |
| InChIKey | UDNJHPWUVJJDDI-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |