C17H14N4O3 — CID 166322105
2,4-dioxo-3-phenyl-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 166322105) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2,4-dioxo-3-phenyl-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 2,4-dioxo-3-phenyl-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 166322105 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2,4-dioxo-3-phenyl-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1c[nH]c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H14N4O3/c22-15(19-10-12-5-4-8-18-9-12)14-11-20-17(24)21(16(14)23)13-6-2-1-3-7-13/h1-9,11H,10H2,(H,19,22)(H,20,24) |
| InChIKey | UDHLMNCNDBIMIZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |