C19H17N3O3 — CID 14444896
N-benzyl-3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carboxamide (PubChem CID 14444896) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-benzyl-3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carboxamide.
| Compound Name | N-benzyl-3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 14444896 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-benzyl-3-methyl-2,4-dioxo-1-phenylpyrimidine-5-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)NCc2ccccc2)cn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C19H17N3O3/c1-21-18(24)16(17(23)20-12-14-8-4-2-5-9-14)13-22(19(21)25)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3,(H,20,23) |
| InChIKey | OTFSTOATGYVACV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |