C33H32N4O3 — CID 98456274
(4S,5S)-4-N,5-N,1,3-tetrabenzyl-2-oxoimidazolidine-4,5-dicarboxamide (PubChem CID 98456274) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is (4S,5S)-4-N,5-N,1,3-tetrabenzyl-2-oxoimidazolidine-4,5-dicarboxamide.
| Compound Name | (4S,5S)-4-N,5-N,1,3-tetrabenzyl-2-oxoimidazolidine-4,5-dicarboxamide |
|---|---|
| PubChem CID | 98456274 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (4S,5S)-4-N,5-N,1,3-tetrabenzyl-2-oxoimidazolidine-4,5-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1[C@@H](C(=O)NCc2ccccc2)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H32N4O3/c38-31(34-21-25-13-5-1-6-14-25)29-30(32(39)35-22-26-15-7-2-8-16-26)37(24-28-19-11-4-12-20-28)33(40)36(29)23-27-17-9-3-10-18-27/h1-20,29-30H,21-24H2,(H,34,38)(H,35,39)/t29-,30-/m0/s1 |
| InChIKey | DVZHYKZTGHFDAZ-KYJUHHDHSA-N |
| XLogP | 4.49 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |