C11H8ClFN2O2 — CID 123611354
7-chloro-6-(2-fluoroethylimino)quinoline-5,8-dione (PubChem CID 123611354) has the molecular formula C11H8ClFN2O2 and a molecular weight of 254.65 g/mol. Its IUPAC name is 7-chloro-6-(2-fluoroethylimino)quinoline-5,8-dione.
| Compound Name | 7-chloro-6-(2-fluoroethylimino)quinoline-5,8-dione |
|---|---|
| PubChem CID | 123611354 |
| Molecular Formula | C11H8ClFN2O2 |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 7-chloro-6-(2-fluoroethylimino)quinoline-5,8-dione |
| SMILES | O=C1/C(=N/CCF)C(Cl)C(=O)c2ncccc21 |
| InChI | InChI=1S/C11H8ClFN2O2/c12-7-9(15-5-3-13)10(16)6-2-1-4-14-8(6)11(7)17/h1-2,4,7H,3,5H2/b15-9+ |
| InChIKey | JAAOEIGDTCOGKA-OQLLNIDSSA-N |
| XLogP | 1.48 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|