C17H11F3N2O2S2 — CID 57316978
7-methylsulfanyl-6-[2-(trifluoromethylsulfanyl)phenyl]iminoquinoline-5,8-dione (PubChem CID 57316978) has the molecular formula C17H11F3N2O2S2 and a molecular weight of 396.42 g/mol. Its IUPAC name is 7-methylsulfanyl-6-[2-(trifluoromethylsulfanyl)phenyl]iminoquinoline-5,8-dione.
| Compound Name | 7-methylsulfanyl-6-[2-(trifluoromethylsulfanyl)phenyl]iminoquinoline-5,8-dione |
|---|---|
| PubChem CID | 57316978 |
| Molecular Formula | C17H11F3N2O2S2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 7-methylsulfanyl-6-[2-(trifluoromethylsulfanyl)phenyl]iminoquinoline-5,8-dione |
| SMILES | CSC1C(=O)c2ncccc2C(=O)/C1=N/c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C17H11F3N2O2S2/c1-25-16-13(14(23)9-5-4-8-21-12(9)15(16)24)22-10-6-2-3-7-11(10)26-17(18,19)20/h2-8,16H,1H3/b22-13- |
| InChIKey | YMTJWHNGHKFHJS-XKZIYDEJSA-N |
| XLogP | 4.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|