C15H11N3O4SZn — CID 175077808
zinc;2,3-dipyridin-2-ylpyridine;sulfate (PubChem CID 175077808) has the molecular formula C15H11N3O4SZn and a molecular weight of 394.73 g/mol. Its IUPAC name is zinc;2,3-dipyridin-2-ylpyridine;sulfate.
| Compound Name | zinc;2,3-dipyridin-2-ylpyridine;sulfate |
|---|---|
| PubChem CID | 175077808 |
| Molecular Formula | C15H11N3O4SZn |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | zinc;2,3-dipyridin-2-ylpyridine;sulfate |
| SMILES | O=S(=O)([O-])[O-].[Zn+2].c1ccc(-c2cccnc2-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H11N3.H2O4S.Zn/c1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;1-5(2,3)4;/h1-11H;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | HRGFBBOQPVTJNO-UHFFFAOYSA-L |
| XLogP | 1.87 |
| TPSA | 118.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|