C19H16N4O3Ru — CID 175143343
2,3-dipyridin-2-ylpyridine;1-hydroxypyrrolidine-2,5-dione;ruthenium (PubChem CID 175143343) has the molecular formula C19H16N4O3Ru and a molecular weight of 449.43 g/mol. Its IUPAC name is 2,3-dipyridin-2-ylpyridine;1-hydroxypyrrolidine-2,5-dione;ruthenium.
| Compound Name | 2,3-dipyridin-2-ylpyridine;1-hydroxypyrrolidine-2,5-dione;ruthenium |
|---|---|
| PubChem CID | 175143343 |
| Molecular Formula | C19H16N4O3Ru |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 2,3-dipyridin-2-ylpyridine;1-hydroxypyrrolidine-2,5-dione;ruthenium |
| SMILES | O=C1CCC(=O)N1O.[Ru].c1ccc(-c2cccnc2-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H11N3.C4H5NO3.Ru/c1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;6-3-1-2-4(7)5(3)8;/h1-11H;8H,1-2H2; |
| InChIKey | DWVYKTTUYNGFQA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|