About N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese
N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese (PubChem CID 174834499) has the molecular formula C33H26MnN4
and a molecular weight of 533.54 g/mol. Its IUPAC name is N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese.
Molecular Properties
| Compound Name | N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese |
| PubChem CID | 174834499 |
| Molecular Formula | C33H26MnN4 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese |
| SMILES | [Mn].c1ccc(-c2cccnc2-c2ccccn2)nc1.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C15H11N3.Mn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;/h1-15H;1-11H; |
| InChIKey | HHWNOGXSDPXBOY-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese?
The IUPAC name of N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese (CID 174834499) is N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese.
What is the SMILES notation for N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese?
The canonical SMILES for N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese is [Mn].c1ccc(-c2cccnc2-c2ccccn2)nc1.c1ccc(N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese?
The InChIKey is HHWNOGXSDPXBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C15H11N3.Mn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;/h1-15H;1-11H;.
What are the key properties of N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese?
N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese has a molecular weight of 533.54 g/mol, XLogP of 8.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenylaniline;2,3-dipyridin-2-ylpyridine;manganese is sourced from PubChem (CID 174834499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).