C27H21N3 — CID 67006222
1,1'-biphenyl;2,3-dipyridin-2-ylpyridine (PubChem CID 67006222) has the molecular formula C27H21N3 and a molecular weight of 387.49 g/mol. Its IUPAC name is 1,1'-biphenyl;2,3-dipyridin-2-ylpyridine.
| Compound Name | 1,1'-biphenyl;2,3-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 67006222 |
| Molecular Formula | C27H21N3 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1,1'-biphenyl;2,3-dipyridin-2-ylpyridine |
| SMILES | c1ccc(-c2ccccc2)cc1.c1ccc(-c2cccnc2-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H11N3.C12H10/c1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-11H;1-10H |
| InChIKey | VSDAUOYWTDTMJI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |