C17H11ClO3 — CID 139943473
2-[(4-chlorophenyl)methoxy]naphthalene-1,4-dione (PubChem CID 139943473) has the molecular formula C17H11ClO3 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methoxy]naphthalene-1,4-dione.
| Compound Name | 2-[(4-chlorophenyl)methoxy]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139943473 |
| Molecular Formula | C17H11ClO3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methoxy]naphthalene-1,4-dione |
| SMILES | O=C1C=C(OCc2ccc(Cl)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H11ClO3/c18-12-7-5-11(6-8-12)10-21-16-9-15(19)13-3-1-2-4-14(13)17(16)20/h1-9H,10H2 |
| InChIKey | SOXQWHHAZXOTEK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|