C18H12ClNO4 — CID 11067825
4-[(4-chlorophenyl)methoxy]-5-phenylpyridine-2,3,6-trione (PubChem CID 11067825) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-5-phenylpyridine-2,3,6-trione.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-5-phenylpyridine-2,3,6-trione |
|---|---|
| PubChem CID | 11067825 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-5-phenylpyridine-2,3,6-trione |
| SMILES | O=C1NC(=O)C(c2ccccc2)=C(OCc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H12ClNO4/c19-13-8-6-11(7-9-13)10-24-16-14(12-4-2-1-3-5-12)17(22)20-18(23)15(16)21/h1-9H,10H2,(H,20,22,23) |
| InChIKey | CWECUNMOWAUGEG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|