C22H16ClN3O — CID 6413361
3-[(4-chlorophenyl)methoxy]-5,6-diphenyl-1,2,4-triazine (PubChem CID 6413361) has the molecular formula C22H16ClN3O and a molecular weight of 373.84 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methoxy]-5,6-diphenyl-1,2,4-triazine.
| Compound Name | 3-[(4-chlorophenyl)methoxy]-5,6-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 6413361 |
| Molecular Formula | C22H16ClN3O |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-[(4-chlorophenyl)methoxy]-5,6-diphenyl-1,2,4-triazine |
| SMILES | Clc1ccc(COc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H16ClN3O/c23-19-13-11-16(12-14-19)15-27-22-24-20(17-7-3-1-4-8-17)21(25-26-22)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChIKey | XWJBHJBDOCVXAS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |