C15H17O3P — CID 144551872
2-(3-methyl-4-phosphanylbutoxy)naphthalene-1,4-dione (PubChem CID 144551872) has the molecular formula C15H17O3P and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-(3-methyl-4-phosphanylbutoxy)naphthalene-1,4-dione.
| Compound Name | 2-(3-methyl-4-phosphanylbutoxy)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 144551872 |
| Molecular Formula | C15H17O3P |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-(3-methyl-4-phosphanylbutoxy)naphthalene-1,4-dione |
| SMILES | CC(CP)CCOC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17O3P/c1-10(9-19)6-7-18-14-8-13(16)11-4-2-3-5-12(11)15(14)17/h2-5,8,10H,6-7,9,19H2,1H3 |
| InChIKey | MMOVCHFTRMYYDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|