C23H16ClNO3 — CID 162676522
2-[4-[(3-chlorophenyl)methoxy]anilino]naphthalene-1,4-dione (PubChem CID 162676522) has the molecular formula C23H16ClNO3 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-[4-[(3-chlorophenyl)methoxy]anilino]naphthalene-1,4-dione.
| Compound Name | 2-[4-[(3-chlorophenyl)methoxy]anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 162676522 |
| Molecular Formula | C23H16ClNO3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-[4-[(3-chlorophenyl)methoxy]anilino]naphthalene-1,4-dione |
| SMILES | O=C1C=C(Nc2ccc(OCc3cccc(Cl)c3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H16ClNO3/c24-16-5-3-4-15(12-16)14-28-18-10-8-17(9-11-18)25-21-13-22(26)19-6-1-2-7-20(19)23(21)27/h1-13,25H,14H2 |
| InChIKey | UOOAJGZSHHKZOZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|