C20H19NO2 — CID 10566503
2-(4-butylanilino)naphthalene-1,4-dione (PubChem CID 10566503) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(4-butylanilino)naphthalene-1,4-dione.
| Compound Name | 2-(4-butylanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10566503 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-(4-butylanilino)naphthalene-1,4-dione |
| SMILES | CCCCc1ccc(NC2=CC(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H19NO2/c1-2-3-6-14-9-11-15(12-10-14)21-18-13-19(22)16-7-4-5-8-17(16)20(18)23/h4-5,7-13,21H,2-3,6H2,1H3 |
| InChIKey | RLQZDJUTVONQHG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|