C17H13NO2S — CID 138969808
2-(4-methylsulfanylanilino)naphthalene-1,4-dione (PubChem CID 138969808) has the molecular formula C17H13NO2S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(4-methylsulfanylanilino)naphthalene-1,4-dione.
| Compound Name | 2-(4-methylsulfanylanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 138969808 |
| Molecular Formula | C17H13NO2S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(4-methylsulfanylanilino)naphthalene-1,4-dione |
| SMILES | CSc1ccc(NC2=CC(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H13NO2S/c1-21-12-8-6-11(7-9-12)18-15-10-16(19)13-4-2-3-5-14(13)17(15)20/h2-10,18H,1H3 |
| InChIKey | JIZYPECYCJQTCJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|