C26H32N2O4S — CID 25048049
N-(4-butylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25048049) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-(4-butylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25048049 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-(4-butylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)C2=C(N(CCC)CCC)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H32N2O4S/c1-4-7-10-19-13-15-20(16-14-19)27-33(31,32)26-23(28(17-5-2)18-6-3)24(29)21-11-8-9-12-22(21)25(26)30/h8-9,11-16,27H,4-7,10,17-18H2,1-3H3 |
| InChIKey | WUOYJBJIJFLYMN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|