C16H16Cl3NO2S — CID 22773924
N-(4-butylphenyl)-2,4,5-trichlorobenzenesulfonamide (PubChem CID 22773924) has the molecular formula C16H16Cl3NO2S and a molecular weight of 392.74 g/mol. Its IUPAC name is N-(4-butylphenyl)-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-(4-butylphenyl)-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 22773924 |
| Molecular Formula | C16H16Cl3NO2S |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | N-(4-butylphenyl)-2,4,5-trichlorobenzenesulfonamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl3NO2S/c1-2-3-4-11-5-7-12(8-6-11)20-23(21,22)16-10-14(18)13(17)9-15(16)19/h5-10,20H,2-4H2,1H3 |
| InChIKey | ZIOJQPSSNNDEDU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|