C20H20N2O4S — CID 25037475
3-(diethylamino)-1,4-dioxo-N-phenylnaphthalene-2-sulfonamide (PubChem CID 25037475) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-(diethylamino)-1,4-dioxo-N-phenylnaphthalene-2-sulfonamide.
| Compound Name | 3-(diethylamino)-1,4-dioxo-N-phenylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25037475 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-(diethylamino)-1,4-dioxo-N-phenylnaphthalene-2-sulfonamide |
| SMILES | CCN(CC)C1=C(S(=O)(=O)Nc2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H20N2O4S/c1-3-22(4-2)17-18(23)15-12-8-9-13-16(15)19(24)20(17)27(25,26)21-14-10-6-5-7-11-14/h5-13,21H,3-4H2,1-2H3 |
| InChIKey | JKUNHAQBZMWPKT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|