C17H21NO4S — CID 14053079
2-(dipropylamino)-3-methylsulfonylnaphthalene-1,4-dione (PubChem CID 14053079) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-(dipropylamino)-3-methylsulfonylnaphthalene-1,4-dione.
| Compound Name | 2-(dipropylamino)-3-methylsulfonylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 14053079 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(dipropylamino)-3-methylsulfonylnaphthalene-1,4-dione |
| SMILES | CCCN(CCC)C1=C(S(C)(=O)=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H21NO4S/c1-4-10-18(11-5-2)14-15(19)12-8-6-7-9-13(12)16(20)17(14)23(3,21)22/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | UFXPOZVPLUUGPW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|