About 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide
3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 23931963) has the molecular formula C20H28N2O6S
and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide |
| PubChem CID | 23931963 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | CCCN(CCC)C1=C(S(=O)(=O)N(CCO)CCO)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H28N2O6S/c1-3-9-21(10-4-2)17-18(25)15-7-5-6-8-16(15)19(26)20(17)29(27,28)22(11-13-23)12-14-24/h5-8,23-24H,3-4,9-14H2,1-2H3 |
| InChIKey | LFYVADSGCJMXAN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide?
The IUPAC name of 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide (CID 23931963) is 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide.
What is the SMILES notation for 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide?
The canonical SMILES for 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide is CCCN(CCC)C1=C(S(=O)(=O)N(CCO)CCO)C(=O)c2ccccc2C1=O.
What is the InChIKey of 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide?
The InChIKey is LFYVADSGCJMXAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O6S/c1-3-9-21(10-4-2)17-18(25)15-7-5-6-8-16(15)19(26)20(17)29(27,28)22(11-13-23)12-14-24/h5-8,23-24H,3-4,9-14H2,1-2H3.
What are the key properties of 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide?
3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide has a molecular weight of 424.52 g/mol, XLogP of 1.02, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dipropylamino)-N,N-bis(2-hydroxyethyl)-1,4-dioxonaphthalene-2-sulfonamide is sourced from PubChem (CID 23931963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).