C24H28N2O4S — CID 25037287
N-(2,5-dimethylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25037287) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25037287 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-(dipropylamino)-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | CCCN(CCC)C1=C(S(=O)(=O)Nc2cc(C)ccc2C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H28N2O4S/c1-5-13-26(14-6-2)21-22(27)18-9-7-8-10-19(18)23(28)24(21)31(29,30)25-20-15-16(3)11-12-17(20)4/h7-12,15,25H,5-6,13-14H2,1-4H3 |
| InChIKey | YYQNUTHSHLNSCN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|