C10H16N2O2S — CID 3889138
2-(dimethylsulfamoylamino)-1,4-dimethylbenzene (PubChem CID 3889138) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-1,4-dimethylbenzene.
| Compound Name | 2-(dimethylsulfamoylamino)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 3889138 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C10H16N2O2S/c1-8-5-6-9(2)10(7-8)11-15(13,14)12(3)4/h5-7,11H,1-4H3 |
| InChIKey | GWSQHQUVTXTLFA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |