4-(dimethylsulfamoylamino)-3-methylbenzoic acid

C10H14N2O4S — CID 28787969

IUPAC4-(dimethylsulfamoylamino)-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1NS(=O)(=O)N(C)C
InChIInChI=1S/C10H14N2O4S/c1-7-6-8(10(13)14)4-5-9(7)11-17(15,16)12(2)3/h4-6,11H,1-3H3,(H,13,14)
InChIKeyOYQMQFDPRKEHOE-UHFFFAOYSA-N
MW258.30 g/mol
LogP0.91
Rot. Bonds4

About 4-(dimethylsulfamoylamino)-3-methylbenzoic acid

4-(dimethylsulfamoylamino)-3-methylbenzoic acid (PubChem CID 28787969) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-(dimethylsulfamoylamino)-3-methylbenzoic acid.

Molecular Properties

Compound Name4-(dimethylsulfamoylamino)-3-methylbenzoic acid
PubChem CID28787969
Molecular FormulaC10H14N2O4S
Molecular Weight258.30 g/mol
Exact Mass258.07
IUPAC Name4-(dimethylsulfamoylamino)-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1NS(=O)(=O)N(C)C
InChIInChI=1S/C10H14N2O4S/c1-7-6-8(10(13)14)4-5-9(7)11-17(15,16)12(2)3/h4-6,11H,1-3H3,(H,13,14)
InChIKeyOYQMQFDPRKEHOE-UHFFFAOYSA-N
XLogP0.91
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.30
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(dimethylsulfamoylamino)-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(dimethylsulfamoylamino)-4-methylbenzoic acid
CID 28788003
4-(dimethylsulfamoylamino)benzoic acid
CID 653734
3-(dimethylsulfamoylamino)-4-propoxybenzoic acid
CID 110504303
4-(cyclopropylmethylsulfonylamino)-3-methylbenzoic acid
CID 64987418
3-methyl-4-(piperazin-1-ylsulfonylamino)benzoic acid
CID 61254687
4-[(3-chloro-2-methylpropyl)sulfonylamino]-3-methylbenzoic acid
CID 79586212
4-(2,4-dimethylanilino)-3-methylbenzoic acid
CID 55225092
3-[[butyl(methyl)sulfamoyl]amino]-4-methylbenzoic acid
CID 43351250
3-methyl-4-(1H-pyrazol-4-ylsulfonylamino)benzoic acid
CID 54937391
3-methyl-4-(1-methylsulfonylpropan-2-ylamino)benzoic acid
CID 64629137
2-(dimethylsulfamoylamino)-1,4-dimethylbenzene
CID 3889138
3-methyl-4-[(4-methylbenzoyl)amino]benzoic acid
CID 16777399

Frequently Asked Questions

What is the IUPAC name of 4-(dimethylsulfamoylamino)-3-methylbenzoic acid?
The IUPAC name of 4-(dimethylsulfamoylamino)-3-methylbenzoic acid (CID 28787969) is 4-(dimethylsulfamoylamino)-3-methylbenzoic acid.
What is the SMILES notation for 4-(dimethylsulfamoylamino)-3-methylbenzoic acid?
The canonical SMILES for 4-(dimethylsulfamoylamino)-3-methylbenzoic acid is Cc1cc(C(=O)O)ccc1NS(=O)(=O)N(C)C.
What is the InChIKey of 4-(dimethylsulfamoylamino)-3-methylbenzoic acid?
The InChIKey is OYQMQFDPRKEHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4S/c1-7-6-8(10(13)14)4-5-9(7)11-17(15,16)12(2)3/h4-6,11H,1-3H3,(H,13,14).
What are the key properties of 4-(dimethylsulfamoylamino)-3-methylbenzoic acid?
4-(dimethylsulfamoylamino)-3-methylbenzoic acid has a molecular weight of 258.30 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylsulfamoylamino)-3-methylbenzoic acid is sourced from PubChem (CID 28787969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).