C21H28N2O4S — CID 50767094
3-[(2,5-dimethylphenyl)sulfonylamino]-4-(dipropylamino)benzoic acid (PubChem CID 50767094) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)sulfonylamino]-4-(dipropylamino)benzoic acid.
| Compound Name | 3-[(2,5-dimethylphenyl)sulfonylamino]-4-(dipropylamino)benzoic acid |
|---|---|
| PubChem CID | 50767094 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)sulfonylamino]-4-(dipropylamino)benzoic acid |
| SMILES | CCCN(CCC)c1ccc(C(=O)O)cc1NS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C21H28N2O4S/c1-5-11-23(12-6-2)19-10-9-17(21(24)25)14-18(19)22-28(26,27)20-13-15(3)7-8-16(20)4/h7-10,13-14,22H,5-6,11-12H2,1-4H3,(H,24,25) |
| InChIKey | DBKRMETVKRZNKJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |