C17H22N2O4S2 — CID 46292359
4-(dipropylamino)-3-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 46292359) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(dipropylamino)-3-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 4-(dipropylamino)-3-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 46292359 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-(dipropylamino)-3-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | CCCN(CCC)c1ccc(C(=O)O)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-3-9-19(10-4-2)15-8-7-13(17(20)21)12-14(15)18-25(22,23)16-6-5-11-24-16/h5-8,11-12,18H,3-4,9-10H2,1-2H3,(H,20,21) |
| InChIKey | IKFURWUWPCGLJL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |