C20H26N2O5S — CID 50767103
4-[butyl(ethyl)amino]-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 50767103) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-[butyl(ethyl)amino]-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[butyl(ethyl)amino]-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50767103 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[butyl(ethyl)amino]-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | CCCCN(CC)c1ccc(C(=O)O)cc1NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-4-6-13-22(5-2)19-12-7-15(20(23)24)14-18(19)21-28(25,26)17-10-8-16(27-3)9-11-17/h7-12,14,21H,4-6,13H2,1-3H3,(H,23,24) |
| InChIKey | MJVMMSOWYYJODA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |