C26H28N2O5S — CID 46292415
3-[(4-acetylphenyl)sulfonylamino]-4-[benzyl(butyl)amino]benzoic acid (PubChem CID 46292415) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[(4-acetylphenyl)sulfonylamino]-4-[benzyl(butyl)amino]benzoic acid.
| Compound Name | 3-[(4-acetylphenyl)sulfonylamino]-4-[benzyl(butyl)amino]benzoic acid |
|---|---|
| PubChem CID | 46292415 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 3-[(4-acetylphenyl)sulfonylamino]-4-[benzyl(butyl)amino]benzoic acid |
| SMILES | CCCCN(Cc1ccccc1)c1ccc(C(=O)O)cc1NS(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C26H28N2O5S/c1-3-4-16-28(18-20-8-6-5-7-9-20)25-15-12-22(26(30)31)17-24(25)27-34(32,33)23-13-10-21(11-14-23)19(2)29/h5-15,17,27H,3-4,16,18H2,1-2H3,(H,30,31) |
| InChIKey | XXLOVSAUFMJGCH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |