C17H23N3O4S2 — CID 46292396
4-[2-(dimethylamino)ethyl-ethylamino]-3-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 46292396) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl-ethylamino]-3-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 4-[2-(dimethylamino)ethyl-ethylamino]-3-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 46292396 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl-ethylamino]-3-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | CCN(CCN(C)C)c1ccc(C(=O)O)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-4-20(10-9-19(2)3)15-8-7-13(17(21)22)12-14(15)18-26(23,24)16-6-5-11-25-16/h5-8,11-12,18H,4,9-10H2,1-3H3,(H,21,22) |
| InChIKey | PFIFWAGULVHHMD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |