C22H28N2O6S — CID 23822129
ethyl 1-[3-(diethylamino)-1,4-dioxonaphthalen-2-yl]sulfonylpiperidine-4-carboxylate (PubChem CID 23822129) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 1-[3-(diethylamino)-1,4-dioxonaphthalen-2-yl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(diethylamino)-1,4-dioxonaphthalen-2-yl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 23822129 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | ethyl 1-[3-(diethylamino)-1,4-dioxonaphthalen-2-yl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)C2=C(N(CC)CC)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H28N2O6S/c1-4-23(5-2)18-19(25)16-9-7-8-10-17(16)20(26)21(18)31(28,29)24-13-11-15(12-14-24)22(27)30-6-3/h7-10,15H,4-6,11-14H2,1-3H3 |
| InChIKey | PUBSGAJVVSLECJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|