C21H29N3O4S — CID 42284589
ethyl 1-(3-tert-butyl-1-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate (PubChem CID 42284589) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is ethyl 1-(3-tert-butyl-1-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-tert-butyl-1-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 42284589 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl 1-(3-tert-butyl-1-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cn(-c3ccccc3)nc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H29N3O4S/c1-5-28-20(25)16-11-13-23(14-12-16)29(26,27)18-15-24(17-9-7-6-8-10-17)22-19(18)21(2,3)4/h6-10,15-16H,5,11-14H2,1-4H3 |
| InChIKey | NNGFILPOQCGWEZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |