C24H27N3O4S — CID 42348035
ethyl 1-(1-benzyl-3-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate (PubChem CID 42348035) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 1-(1-benzyl-3-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(1-benzyl-3-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 42348035 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | ethyl 1-(1-benzyl-3-phenylpyrazol-4-yl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cn(Cc3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N3O4S/c1-2-31-24(28)21-13-15-27(16-14-21)32(29,30)22-18-26(17-19-9-5-3-6-10-19)25-23(22)20-11-7-4-8-12-20/h3-12,18,21H,2,13-17H2,1H3 |
| InChIKey | BMNCTKZBMVVDBP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |