C21H24N4O4S2 — CID 42351367
ethyl 4-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)sulfonylpiperazine-1-carboxylate (PubChem CID 42351367) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is ethyl 4-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 42351367 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | ethyl 4-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2cn(Cc3ccccc3)nc2-c2cccs2)CC1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-2-29-21(26)23-10-12-25(13-11-23)31(27,28)19-16-24(15-17-7-4-3-5-8-17)22-20(19)18-9-6-14-30-18/h3-9,14,16H,2,10-13,15H2,1H3 |
| InChIKey | BRDGECLVMSFQGH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |