C18H33N3O2S — CID 70411428
1-[4-(dibutylamino)butyl]-4-(sulfamoylamino)benzene (PubChem CID 70411428) has the molecular formula C18H33N3O2S and a molecular weight of 355.55 g/mol. Its IUPAC name is 1-[4-(dibutylamino)butyl]-4-(sulfamoylamino)benzene.
| Compound Name | 1-[4-(dibutylamino)butyl]-4-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 70411428 |
| Molecular Formula | C18H33N3O2S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-[4-(dibutylamino)butyl]-4-(sulfamoylamino)benzene |
| SMILES | CCCCN(CCCC)CCCCc1ccc(NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H33N3O2S/c1-3-5-14-21(15-6-4-2)16-8-7-9-17-10-12-18(13-11-17)20-24(19,22)23/h10-13,20H,3-9,14-16H2,1-2H3,(H2,19,22,23) |
| InChIKey | IJAMSHKZOLEXMZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|