C17H33N3O2S — CID 70411356
1-[[ethyl(heptyl)amino]methyl]-4-(sulfamoylamino)benzene;methane (PubChem CID 70411356) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is 1-[[ethyl(heptyl)amino]methyl]-4-(sulfamoylamino)benzene;methane.
| Compound Name | 1-[[ethyl(heptyl)amino]methyl]-4-(sulfamoylamino)benzene;methane |
|---|---|
| PubChem CID | 70411356 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[[ethyl(heptyl)amino]methyl]-4-(sulfamoylamino)benzene;methane |
| SMILES | C.CCCCCCCN(CC)Cc1ccc(NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H29N3O2S.CH4/c1-3-5-6-7-8-13-19(4-2)14-15-9-11-16(12-10-15)18-22(17,20)21;/h9-12,18H,3-8,13-14H2,1-2H3,(H2,17,20,21);1H4 |
| InChIKey | VEKCMKLRRTYLHS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|