C19H34N2O3S — CID 70412176
N-[4-[2-[ethyl(heptyl)amino]-1-hydroxyethyl]phenyl]ethanesulfonamide (PubChem CID 70412176) has the molecular formula C19H34N2O3S and a molecular weight of 370.56 g/mol. Its IUPAC name is N-[4-[2-[ethyl(heptyl)amino]-1-hydroxyethyl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-[2-[ethyl(heptyl)amino]-1-hydroxyethyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 70412176 |
| Molecular Formula | C19H34N2O3S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N-[4-[2-[ethyl(heptyl)amino]-1-hydroxyethyl]phenyl]ethanesulfonamide |
| SMILES | CCCCCCCN(CC)CC(O)c1ccc(NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C19H34N2O3S/c1-4-7-8-9-10-15-21(5-2)16-19(22)17-11-13-18(14-12-17)20-25(23,24)6-3/h11-14,19-20,22H,4-10,15-16H2,1-3H3 |
| InChIKey | LTHBGKLDPJLNMM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|