C20H36N2O3S — CID 14891471
N-[3-[4-[ethyl(heptyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide (PubChem CID 14891471) has the molecular formula C20H36N2O3S and a molecular weight of 384.59 g/mol. Its IUPAC name is N-[3-[4-[ethyl(heptyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[4-[ethyl(heptyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14891471 |
| Molecular Formula | C20H36N2O3S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[3-[4-[ethyl(heptyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide |
| SMILES | CCCCCCCN(CC)CCCC(O)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H36N2O3S/c1-4-6-7-8-9-15-22(5-2)16-11-14-20(23)18-12-10-13-19(17-18)21-26(3,24)25/h10,12-13,17,20-21,23H,4-9,11,14-16H2,1-3H3 |
| InChIKey | QDJRYVDHLQOPBX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|