C22H41N3O3S — CID 70411210
1-[4-[decyl(ethyl)amino]-1-hydroxybutyl]-4-(sulfamoylamino)benzene (PubChem CID 70411210) has the molecular formula C22H41N3O3S and a molecular weight of 427.66 g/mol. Its IUPAC name is 1-[4-[decyl(ethyl)amino]-1-hydroxybutyl]-4-(sulfamoylamino)benzene.
| Compound Name | 1-[4-[decyl(ethyl)amino]-1-hydroxybutyl]-4-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 70411210 |
| Molecular Formula | C22H41N3O3S |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-[4-[decyl(ethyl)amino]-1-hydroxybutyl]-4-(sulfamoylamino)benzene |
| SMILES | CCCCCCCCCCN(CC)CCCC(O)c1ccc(NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H41N3O3S/c1-3-5-6-7-8-9-10-11-18-25(4-2)19-12-13-22(26)20-14-16-21(17-15-20)24-29(23,27)28/h14-17,22,24,26H,3-13,18-19H2,1-2H3,(H2,23,27,28) |
| InChIKey | HDJDCTNOYOCPDV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|