C20H34F2N2O3S — CID 10812091
N-[4-[(1S)-4-[7,7-difluoroheptyl(ethyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide (PubChem CID 10812091) has the molecular formula C20H34F2N2O3S and a molecular weight of 420.57 g/mol. Its IUPAC name is N-[4-[(1S)-4-[7,7-difluoroheptyl(ethyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(1S)-4-[7,7-difluoroheptyl(ethyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 10812091 |
| Molecular Formula | C20H34F2N2O3S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[4-[(1S)-4-[7,7-difluoroheptyl(ethyl)amino]-1-hydroxybutyl]phenyl]methanesulfonamide |
| SMILES | CCN(CCCCCCC(F)F)CCC[C@H](O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H34F2N2O3S/c1-3-24(15-7-5-4-6-10-20(21)22)16-8-9-19(25)17-11-13-18(14-12-17)23-28(2,26)27/h11-14,19-20,23,25H,3-10,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | ZXJGYRBCFSVIEQ-IBGZPJMESA-N |
| XLogP | 4.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|