C21H37BrN2O3S — CID 70410686
N-[4-[4-(1-butylazepan-1-ium-1-yl)-1-hydroxybutyl]phenyl]methanesulfonamide bromide (PubChem CID 70410686) has the molecular formula C21H37BrN2O3S and a molecular weight of 477.51 g/mol. Its IUPAC name is N-[4-[4-(1-butylazepan-1-ium-1-yl)-1-hydroxybutyl]phenyl]methanesulfonamide bromide.
| Compound Name | N-[4-[4-(1-butylazepan-1-ium-1-yl)-1-hydroxybutyl]phenyl]methanesulfonamide bromide |
|---|---|
| PubChem CID | 70410686 |
| Molecular Formula | C21H37BrN2O3S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[4-[4-(1-butylazepan-1-ium-1-yl)-1-hydroxybutyl]phenyl]methanesulfonamide bromide |
| SMILES | CCCC[N+]1(CCCC(O)c2ccc(NS(C)(=O)=O)cc2)CCCCCC1.[Br-] |
| InChI | InChI=1S/C21H37N2O3S.BrH/c1-3-4-15-23(16-7-5-6-8-17-23)18-9-10-21(24)19-11-13-20(14-12-19)22-27(2,25)26;/h11-14,21-22,24H,3-10,15-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WBKKLVAYPNYFSH-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|