C12H20AsNO3S — CID 173166355
N-[4-(1-hydroxy-2-propan-2-ylarsanylethyl)phenyl]methanesulfonamide (PubChem CID 173166355) has the molecular formula C12H20AsNO3S and a molecular weight of 333.29 g/mol. Its IUPAC name is N-[4-(1-hydroxy-2-propan-2-ylarsanylethyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(1-hydroxy-2-propan-2-ylarsanylethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 173166355 |
| Molecular Formula | C12H20AsNO3S |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[4-(1-hydroxy-2-propan-2-ylarsanylethyl)phenyl]methanesulfonamide |
| SMILES | CC(C)[AsH]CC(O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20AsNO3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 |
| InChIKey | SBUVKZKJBLYZLW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|