C44H76N4O10S2 — CID 24820163
(E)-but-2-enedioate;bis(ethyl-heptyl-[4-hydroxy-4-[4-(methanesulfonamido)phenyl]butyl]azanium) (PubChem CID 24820163) has the molecular formula C44H76N4O10S2 and a molecular weight of 885.24 g/mol. Its IUPAC name is (E)-but-2-enedioate;bis(ethyl-heptyl-[4-hydroxy-4-[4-(methanesulfonamido)phenyl]butyl]azanium).
| Compound Name | (E)-but-2-enedioate;bis(ethyl-heptyl-[4-hydroxy-4-[4-(methanesulfonamido)phenyl]butyl]azanium) |
|---|---|
| PubChem CID | 24820163 |
| Molecular Formula | C44H76N4O10S2 |
| Molecular Weight | 885.24 g/mol |
| Exact Mass | 884.50 |
| IUPAC Name | (E)-but-2-enedioate;bis(ethyl-heptyl-[4-hydroxy-4-[4-(methanesulfonamido)phenyl]butyl]azanium) |
| SMILES | CCCCCCC[NH+](CC)CCCC(O)c1ccc(NS(C)(=O)=O)cc1.CCCCCCC[NH+](CC)CCCC(O)c1ccc(NS(C)(=O)=O)cc1.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/2C20H36N2O3S.C4H4O4/c2*1-4-6-7-8-9-16-22(5-2)17-10-11-20(23)18-12-14-19(15-13-18)21-26(3,24)25;5-3(6)1-2-4(7)8/h2*12-15,20-21,23H,4-11,16-17H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | PCIOHQNIRPWFMV-WXXKFALUSA-N |
| XLogP | 2.54 |
| TPSA | 221.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|