C24H39FN2O7S — CID 70301359
(E)-but-2-enedioic acid;N-[4-[4-[ethyl-[(6S)-6-fluoroheptyl]amino]-1-hydroxybutyl]phenyl]methanesulfonamide (PubChem CID 70301359) has the molecular formula C24H39FN2O7S and a molecular weight of 518.65 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[4-[4-[ethyl-[(6S)-6-fluoroheptyl]amino]-1-hydroxybutyl]phenyl]methanesulfonamide.
| Compound Name | (E)-but-2-enedioic acid;N-[4-[4-[ethyl-[(6S)-6-fluoroheptyl]amino]-1-hydroxybutyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70301359 |
| Molecular Formula | C24H39FN2O7S |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[4-[4-[ethyl-[(6S)-6-fluoroheptyl]amino]-1-hydroxybutyl]phenyl]methanesulfonamide |
| SMILES | CCN(CCCCC[C@H](C)F)CCCC(O)c1ccc(NS(C)(=O)=O)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H35FN2O3S.C4H4O4/c1-4-23(15-7-5-6-9-17(2)21)16-8-10-20(24)18-11-13-19(14-12-18)22-27(3,25)26;5-3(6)1-2-4(7)8/h11-14,17,20,22,24H,4-10,15-16H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t17-,20?;/m0./s1 |
| InChIKey | INCXQDCNJUGAFW-XIXOTDPDSA-N |
| XLogP | 3.82 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|