C26H46N4O4 — CID 139952883
[ethyl(hexyl)amino]methyl N-[4-[[ethyl(hexyl)amino]methoxycarbonylamino]phenyl]carbamate (PubChem CID 139952883) has the molecular formula C26H46N4O4 and a molecular weight of 478.68 g/mol. Its IUPAC name is [ethyl(hexyl)amino]methyl N-[4-[[ethyl(hexyl)amino]methoxycarbonylamino]phenyl]carbamate.
| Compound Name | [ethyl(hexyl)amino]methyl N-[4-[[ethyl(hexyl)amino]methoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139952883 |
| Molecular Formula | C26H46N4O4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | [ethyl(hexyl)amino]methyl N-[4-[[ethyl(hexyl)amino]methoxycarbonylamino]phenyl]carbamate |
| SMILES | CCCCCCN(CC)COC(=O)Nc1ccc(NC(=O)OCN(CC)CCCCCC)cc1 |
| InChI | InChI=1S/C26H46N4O4/c1-5-9-11-13-19-29(7-3)21-33-25(31)27-23-15-17-24(18-16-23)28-26(32)34-22-30(8-4)20-14-12-10-6-2/h15-18H,5-14,19-22H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | SLPBHQBGAWGKSX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|