C34H62N4O4 — CID 139952468
2-[decyl(methyl)amino]ethyl N-[4-[2-[decyl(methyl)amino]ethoxycarbonylamino]phenyl]carbamate (PubChem CID 139952468) has the molecular formula C34H62N4O4 and a molecular weight of 590.89 g/mol. Its IUPAC name is 2-[decyl(methyl)amino]ethyl N-[4-[2-[decyl(methyl)amino]ethoxycarbonylamino]phenyl]carbamate.
| Compound Name | 2-[decyl(methyl)amino]ethyl N-[4-[2-[decyl(methyl)amino]ethoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139952468 |
| Molecular Formula | C34H62N4O4 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.48 |
| IUPAC Name | 2-[decyl(methyl)amino]ethyl N-[4-[2-[decyl(methyl)amino]ethoxycarbonylamino]phenyl]carbamate |
| SMILES | CCCCCCCCCCN(C)CCOC(=O)Nc1ccc(NC(=O)OCCN(C)CCCCCCCCCC)cc1 |
| InChI | InChI=1S/C34H62N4O4/c1-5-7-9-11-13-15-17-19-25-37(3)27-29-41-33(39)35-31-21-23-32(24-22-31)36-34(40)42-30-28-38(4)26-20-18-16-14-12-10-8-6-2/h21-24H,5-20,25-30H2,1-4H3,(H,35,39)(H,36,40) |
| InChIKey | NJFWKFMAPWMPIX-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|