C24H42N4O4 — CID 139956615
2-[methyl(pentyl)amino]ethyl N-[4-[2-[methyl(pentyl)amino]ethoxycarbonylamino]phenyl]carbamate (PubChem CID 139956615) has the molecular formula C24H42N4O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-[methyl(pentyl)amino]ethyl N-[4-[2-[methyl(pentyl)amino]ethoxycarbonylamino]phenyl]carbamate.
| Compound Name | 2-[methyl(pentyl)amino]ethyl N-[4-[2-[methyl(pentyl)amino]ethoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139956615 |
| Molecular Formula | C24H42N4O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[methyl(pentyl)amino]ethyl N-[4-[2-[methyl(pentyl)amino]ethoxycarbonylamino]phenyl]carbamate |
| SMILES | CCCCCN(C)CCOC(=O)Nc1ccc(NC(=O)OCCN(C)CCCCC)cc1 |
| InChI | InChI=1S/C24H42N4O4/c1-5-7-9-15-27(3)17-19-31-23(29)25-21-11-13-22(14-12-21)26-24(30)32-20-18-28(4)16-10-8-6-2/h11-14H,5-10,15-20H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | KAMZJWCXJCPOSA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|