C22H38N4O4 — CID 139956557
[methyl(pentyl)amino]methyl N-[3-[[methyl(pentyl)amino]methoxycarbonylamino]phenyl]carbamate (PubChem CID 139956557) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is [methyl(pentyl)amino]methyl N-[3-[[methyl(pentyl)amino]methoxycarbonylamino]phenyl]carbamate.
| Compound Name | [methyl(pentyl)amino]methyl N-[3-[[methyl(pentyl)amino]methoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139956557 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | [methyl(pentyl)amino]methyl N-[3-[[methyl(pentyl)amino]methoxycarbonylamino]phenyl]carbamate |
| SMILES | CCCCCN(C)COC(=O)Nc1cccc(NC(=O)OCN(C)CCCCC)c1 |
| InChI | InChI=1S/C22H38N4O4/c1-5-7-9-14-25(3)17-29-21(27)23-19-12-11-13-20(16-19)24-22(28)30-18-26(4)15-10-8-6-2/h11-13,16H,5-10,14-15,17-18H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | BLSWTMJQIXHDKY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|